About 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide
3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide (PubChem CID 46511214) has the molecular formula C23H30FN3O3
and a molecular weight of 415.51 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide.
Molecular Properties
| Compound Name | 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
| PubChem CID | 46511214 |
| Molecular Formula | C23H30FN3O3 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
| SMILES | O=C(CCc1ncc(-c2ccc(F)cc2)o1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C23H30FN3O3/c24-19-6-4-18(5-7-19)20-16-25-22(30-20)9-8-21(28)26-17-23(10-2-1-3-11-23)27-12-14-29-15-13-27/h4-7,16H,1-3,8-15,17H2,(H,26,28) |
| InChIKey | NJGLMLLLEVZQHO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide?
The IUPAC name of 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide (CID 46511214) is 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide.
What is the SMILES notation for 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide?
The canonical SMILES for 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide is O=C(CCc1ncc(-c2ccc(F)cc2)o1)NCC1(N2CCOCC2)CCCCC1.
What is the InChIKey of 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide?
The InChIKey is NJGLMLLLEVZQHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30FN3O3/c24-19-6-4-18(5-7-19)20-16-25-22(30-20)9-8-21(28)26-17-23(10-2-1-3-11-23)27-12-14-29-15-13-27/h4-7,16H,1-3,8-15,17H2,(H,26,28).
What are the key properties of 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide?
3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide has a molecular weight of 415.51 g/mol, XLogP of 3.56, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide is sourced from PubChem (CID 46511214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).