C22H19FN4O5 — CID 46511245
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 46511245) has the molecular formula C22H19FN4O5 and a molecular weight of 438.42 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46511245 |
| Molecular Formula | C22H19FN4O5 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2noc(CN3C(=O)NC(C)(c4ccc5c(c4)OCCO5)C3=O)n2)cc1F |
| InChI | InChI=1S/C22H19FN4O5/c1-12-3-4-13(9-15(12)23)19-24-18(32-26-19)11-27-20(28)22(2,25-21(27)29)14-5-6-16-17(10-14)31-8-7-30-16/h3-6,9-10H,7-8,11H2,1-2H3,(H,25,29) |
| InChIKey | FHALPOZFJMXNIH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|