About N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide
N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 46513080) has the molecular formula C20H20F2N2O2
and a molecular weight of 358.39 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide.
Molecular Properties
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide |
| PubChem CID | 46513080 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CC(c1ccc(F)c(F)c1)N(C)C(=O)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C20H20F2N2O2/c1-13(14-8-9-17(21)18(22)12-14)23(2)20(26)15-5-3-6-16(11-15)24-10-4-7-19(24)25/h3,5-6,8-9,11-13H,4,7,10H2,1-2H3 |
| InChIKey | MYZHXMRUKXOOBW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide?
The IUPAC name of N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide (CID 46513080) is N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide.
What is the SMILES notation for N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide?
The canonical SMILES for N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide is CC(c1ccc(F)c(F)c1)N(C)C(=O)c1cccc(N2CCCC2=O)c1.
What is the InChIKey of N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide?
The InChIKey is MYZHXMRUKXOOBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F2N2O2/c1-13(14-8-9-17(21)18(22)12-14)23(2)20(26)15-5-3-6-16(11-15)24-10-4-7-19(24)25/h3,5-6,8-9,11-13H,4,7,10H2,1-2H3.
What are the key properties of N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide?
N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide has a molecular weight of 358.39 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-difluorophenyl)ethyl]-N-methyl-3-(2-oxopyrrolidin-1-yl)benzamide is sourced from PubChem (CID 46513080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).