C19H23BrN2O4 — CID 46513566
tert-butyl 4-(5-bromo-3-methyl-1-benzofuran-2-carbonyl)piperazine-1-carboxylate (PubChem CID 46513566) has the molecular formula C19H23BrN2O4 and a molecular weight of 423.31 g/mol. Its IUPAC name is tert-butyl 4-(5-bromo-3-methyl-1-benzofuran-2-carbonyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-bromo-3-methyl-1-benzofuran-2-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46513566 |
| Molecular Formula | C19H23BrN2O4 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | tert-butyl 4-(5-bromo-3-methyl-1-benzofuran-2-carbonyl)piperazine-1-carboxylate |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C19H23BrN2O4/c1-12-14-11-13(20)5-6-15(14)25-16(12)17(23)21-7-9-22(10-8-21)18(24)26-19(2,3)4/h5-6,11H,7-10H2,1-4H3 |
| InChIKey | VADBXGZFECGWPV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |