C14H22N4O3 — CID 4651393
4-(4,6-dimethoxypyrimidin-2-yl)-N-ethylpiperidine-1-carboxamide (PubChem CID 4651393) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-(4,6-dimethoxypyrimidin-2-yl)-N-ethylpiperidine-1-carboxamide.
| Compound Name | 4-(4,6-dimethoxypyrimidin-2-yl)-N-ethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 4651393 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 4-(4,6-dimethoxypyrimidin-2-yl)-N-ethylpiperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC(c2nc(OC)cc(OC)n2)CC1 |
| InChI | InChI=1S/C14H22N4O3/c1-4-15-14(19)18-7-5-10(6-8-18)13-16-11(20-2)9-12(17-13)21-3/h9-10H,4-8H2,1-3H3,(H,15,19) |
| InChIKey | HTIGLFICCOZEIE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |