C21H21N3O3 — CID 46514633
N-ethyl-3-[[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]amino]benzamide (PubChem CID 46514633) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-ethyl-3-[[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]amino]benzamide.
| Compound Name | N-ethyl-3-[[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 46514633 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-ethyl-3-[[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]amino]benzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)Cc2nc(-c3ccccc3)oc2C)c1 |
| InChI | InChI=1S/C21H21N3O3/c1-3-22-20(26)16-10-7-11-17(12-16)23-19(25)13-18-14(2)27-21(24-18)15-8-5-4-6-9-15/h4-12H,3,13H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | WYPSJBBWHBTXRQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |