C17H25N3O2 — CID 4651696
1-N,1-N-dimethyl-3-N-(1-phenylethyl)piperidine-1,3-dicarboxamide (PubChem CID 4651696) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-3-N-(1-phenylethyl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N,1-N-dimethyl-3-N-(1-phenylethyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 4651696 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-N,1-N-dimethyl-3-N-(1-phenylethyl)piperidine-1,3-dicarboxamide |
| SMILES | CC(NC(=O)C1CCCN(C(=O)N(C)C)C1)c1ccccc1 |
| InChI | InChI=1S/C17H25N3O2/c1-13(14-8-5-4-6-9-14)18-16(21)15-10-7-11-20(12-15)17(22)19(2)3/h4-6,8-9,13,15H,7,10-12H2,1-3H3,(H,18,21) |
| InChIKey | MTNXIWRYFQBLLY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |