C22H21N3O6 — CID 46517172
[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 46517172) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 46517172 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 3-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(CN2C(=O)CNC2=O)c1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C22H21N3O6/c26-19(24-17-8-9-30-18-7-2-1-6-16(17)18)13-31-21(28)15-5-3-4-14(10-15)12-25-20(27)11-23-22(25)29/h1-7,10,17H,8-9,11-13H2,(H,23,29)(H,24,26) |
| InChIKey | VMSOSCHETRWBRJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|