C20H21N2OS+ — CID 4651823
1-benzyl-2-(4-methoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium (PubChem CID 4651823) has the molecular formula C20H21N2OS+ and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-benzyl-2-(4-methoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium.
| Compound Name | 1-benzyl-2-(4-methoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium |
|---|---|
| PubChem CID | 4651823 |
| Molecular Formula | C20H21N2OS+ |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-benzyl-2-(4-methoxyphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium |
| SMILES | COc1ccc(-c2c[n+]3c(n2Cc2ccccc2)SCCC3)cc1 |
| InChI | InChI=1S/C20H21N2OS/c1-23-18-10-8-17(9-11-18)19-15-21-12-5-13-24-20(21)22(19)14-16-6-3-2-4-7-16/h2-4,6-11,15H,5,12-14H2,1H3/q+1 |
| InChIKey | FLZNIQYNWMEHMX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|