C18H22N4O4S — CID 46518240
N-[4-(methylcarbamoylamino)phenyl]-3-[4-(methylsulfamoyl)phenyl]propanamide (PubChem CID 46518240) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[4-(methylcarbamoylamino)phenyl]-3-[4-(methylsulfamoyl)phenyl]propanamide.
| Compound Name | N-[4-(methylcarbamoylamino)phenyl]-3-[4-(methylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 46518240 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[4-(methylcarbamoylamino)phenyl]-3-[4-(methylsulfamoyl)phenyl]propanamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)CCc2ccc(S(=O)(=O)NC)cc2)cc1 |
| InChI | InChI=1S/C18H22N4O4S/c1-19-18(24)22-15-8-6-14(7-9-15)21-17(23)12-5-13-3-10-16(11-4-13)27(25,26)20-2/h3-4,6-11,20H,5,12H2,1-2H3,(H,21,23)(H2,19,22,24) |
| InChIKey | WHZMNDPISUBAHY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |