C19H21ClN2O2S — CID 46518836
N-(1-benzylpyrrolidin-3-yl)-4-(5-chlorothiophen-2-yl)-4-oxobutanamide (PubChem CID 46518836) has the molecular formula C19H21ClN2O2S and a molecular weight of 376.91 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-4-(5-chlorothiophen-2-yl)-4-oxobutanamide.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-4-(5-chlorothiophen-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 46518836 |
| Molecular Formula | C19H21ClN2O2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-4-(5-chlorothiophen-2-yl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)s1)NC1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H21ClN2O2S/c20-18-8-7-17(25-18)16(23)6-9-19(24)21-15-10-11-22(13-15)12-14-4-2-1-3-5-14/h1-5,7-8,15H,6,9-13H2,(H,21,24) |
| InChIKey | QJGQNGYMEKPWJB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |