C19H19N3O4S — CID 46524259
N-ethyl-3-[[3-(prop-2-ynylsulfamoyl)benzoyl]amino]benzamide (PubChem CID 46524259) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-ethyl-3-[[3-(prop-2-ynylsulfamoyl)benzoyl]amino]benzamide.
| Compound Name | N-ethyl-3-[[3-(prop-2-ynylsulfamoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 46524259 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-ethyl-3-[[3-(prop-2-ynylsulfamoyl)benzoyl]amino]benzamide |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)Nc2cccc(C(=O)NCC)c2)c1 |
| InChI | InChI=1S/C19H19N3O4S/c1-3-11-21-27(25,26)17-10-6-8-15(13-17)19(24)22-16-9-5-7-14(12-16)18(23)20-4-2/h1,5-10,12-13,21H,4,11H2,2H3,(H,20,23)(H,22,24) |
| InChIKey | LULLDLOQHXPKRY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|