C25H24ClN3O4S — CID 46528607
5-(benzylsulfamoyl)-N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-methylbenzamide (PubChem CID 46528607) has the molecular formula C25H24ClN3O4S and a molecular weight of 498.00 g/mol. Its IUPAC name is 5-(benzylsulfamoyl)-N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-methylbenzamide.
| Compound Name | 5-(benzylsulfamoyl)-N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 46528607 |
| Molecular Formula | C25H24ClN3O4S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 5-(benzylsulfamoyl)-N-[3-chloro-4-(2-oxopyrrolidin-1-yl)phenyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccccc2)cc1C(=O)Nc1ccc(N2CCCC2=O)c(Cl)c1 |
| InChI | InChI=1S/C25H24ClN3O4S/c1-17-9-11-20(34(32,33)27-16-18-6-3-2-4-7-18)15-21(17)25(31)28-19-10-12-23(22(26)14-19)29-13-5-8-24(29)30/h2-4,6-7,9-12,14-15,27H,5,8,13,16H2,1H3,(H,28,31) |
| InChIKey | IUKITUMLRQUGOH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |