About ethyl 2-sulfamoylbenzoate
ethyl 2-sulfamoylbenzoate (PubChem CID 4652880) has the molecular formula C9H11NO4S
and a molecular weight of 229.26 g/mol. Its IUPAC name is ethyl 2-sulfamoylbenzoate.
Molecular Properties
| Compound Name | ethyl 2-sulfamoylbenzoate |
| PubChem CID | 4652880 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | ethyl 2-sulfamoylbenzoate |
| SMILES | CCOC(=O)c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C9H11NO4S/c1-2-14-9(11)7-5-3-4-6-8(7)15(10,12)13/h3-6H,2H2,1H3,(H2,10,12,13) |
| InChIKey | CYFKZTWSLPKROH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-sulfamoylbenzoate?
The IUPAC name of ethyl 2-sulfamoylbenzoate (CID 4652880) is ethyl 2-sulfamoylbenzoate.
What is the SMILES notation for ethyl 2-sulfamoylbenzoate?
The canonical SMILES for ethyl 2-sulfamoylbenzoate is CCOC(=O)c1ccccc1S(N)(=O)=O.
What is the InChIKey of ethyl 2-sulfamoylbenzoate?
The InChIKey is CYFKZTWSLPKROH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4S/c1-2-14-9(11)7-5-3-4-6-8(7)15(10,12)13/h3-6H,2H2,1H3,(H2,10,12,13).
What are the key properties of ethyl 2-sulfamoylbenzoate?
ethyl 2-sulfamoylbenzoate has a molecular weight of 229.26 g/mol, XLogP of 0.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-sulfamoylbenzoate is sourced from PubChem (CID 4652880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).