About 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran
5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran (PubChem CID 4653208) has the molecular formula C10H10N2O6
and a molecular weight of 254.20 g/mol. Its IUPAC name is 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran |
| PubChem CID | 4653208 |
| Molecular Formula | C10H10N2O6 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1[N+](=O)[O-])OC(C)C2 |
| InChI | InChI=1S/C10H10N2O6/c1-5-3-6-4-7(17-2)8(11(13)14)9(12(15)16)10(6)18-5/h4-5H,3H2,1-2H3 |
| InChIKey | XXMVBFCCFBFSSJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran?
The IUPAC name of 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran (CID 4653208) is 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran?
The canonical SMILES for 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran is COc1cc2c(c([N+](=O)[O-])c1[N+](=O)[O-])OC(C)C2.
What is the InChIKey of 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran?
The InChIKey is XXMVBFCCFBFSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O6/c1-5-3-6-4-7(17-2)8(11(13)14)9(12(15)16)10(6)18-5/h4-5H,3H2,1-2H3.
What are the key properties of 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran?
5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran has a molecular weight of 254.20 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-methyl-6,7-dinitro-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 4653208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).