C21H20N6O — CID 46532818
N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-1-ethylindole-3-carboxamide (PubChem CID 46532818) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-1-ethylindole-3-carboxamide.
| Compound Name | N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-1-ethylindole-3-carboxamide |
|---|---|
| PubChem CID | 46532818 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-1-ethylindole-3-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2cccc(-c3nnnn3C3CC3)c2)c2ccccc21 |
| InChI | InChI=1S/C21H20N6O/c1-2-26-13-18(17-8-3-4-9-19(17)26)21(28)22-15-7-5-6-14(12-15)20-23-24-25-27(20)16-10-11-16/h3-9,12-13,16H,2,10-11H2,1H3,(H,22,28) |
| InChIKey | MSJMNHQOAQPGDE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |