C22H24FN3OS — CID 46533259
N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide (PubChem CID 46533259) has the molecular formula C22H24FN3OS and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide.
| Compound Name | N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46533259 |
| Molecular Formula | C22H24FN3OS |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
| SMILES | Cn1ccnc1C(NC(=O)c1cc2c(s1)CCCCCC2)c1ccccc1F |
| InChI | InChI=1S/C22H24FN3OS/c1-26-13-12-24-21(26)20(16-9-6-7-10-17(16)23)25-22(27)19-14-15-8-4-2-3-5-11-18(15)28-19/h6-7,9-10,12-14,20H,2-5,8,11H2,1H3,(H,25,27) |
| InChIKey | MRJZDYADAFHCPJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |