C24H28N4O3 — CID 46534495
(E)-3-(3-methoxy-4-propoxyphenyl)-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 46534495) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-propoxyphenyl)-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-methoxy-4-propoxyphenyl)-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46534495 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (E)-3-(3-methoxy-4-propoxyphenyl)-1-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | CCCOc1ccc(/C=C/C(=O)N2CCCC(c3nnc4ccccn34)C2)cc1OC |
| InChI | InChI=1S/C24H28N4O3/c1-3-15-31-20-11-9-18(16-21(20)30-2)10-12-23(29)27-13-6-7-19(17-27)24-26-25-22-8-4-5-14-28(22)24/h4-5,8-12,14,16,19H,3,6-7,13,15,17H2,1-2H3/b12-10+ |
| InChIKey | HYHGHYIYCBLCKP-ZRDIBKRKSA-N |
| XLogP | 3.95 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|