C22H29NO5 — CID 46535842
methyl (E)-3-[4-[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 46535842) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl (E)-3-[4-[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethoxy]-3-methoxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethoxy]-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 46535842 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | methyl (E)-3-[4-[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(OCC(=O)NC(C)C2CC3CCC2C3)c(OC)c1 |
| InChI | InChI=1S/C22H29NO5/c1-14(18-11-16-4-7-17(18)10-16)23-21(24)13-28-19-8-5-15(12-20(19)26-2)6-9-22(25)27-3/h5-6,8-9,12,14,16-18H,4,7,10-11,13H2,1-3H3,(H,23,24)/b9-6+ |
| InChIKey | AVHPNFLULPONOH-RMKNXTFCSA-N |
| XLogP | 3.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|