C16H19NO4 — CID 46536426
N-ethoxy-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide (PubChem CID 46536426) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-ethoxy-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide.
| Compound Name | N-ethoxy-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide |
|---|---|
| PubChem CID | 46536426 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-ethoxy-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide |
| SMILES | CCONC(=O)COc1ccc2oc3c(c2c1)CCCC3 |
| InChI | InChI=1S/C16H19NO4/c1-2-20-17-16(18)10-19-11-7-8-15-13(9-11)12-5-3-4-6-14(12)21-15/h7-9H,2-6,10H2,1H3,(H,17,18) |
| InChIKey | ONOZHRGIGYLQHH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|