C17H18BrNO4S — CID 46538767
methyl 3-[2-(4-bromophenoxy)propanoylamino]-3-thiophen-2-ylpropanoate (PubChem CID 46538767) has the molecular formula C17H18BrNO4S and a molecular weight of 412.31 g/mol. Its IUPAC name is methyl 3-[2-(4-bromophenoxy)propanoylamino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[2-(4-bromophenoxy)propanoylamino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 46538767 |
| Molecular Formula | C17H18BrNO4S |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | methyl 3-[2-(4-bromophenoxy)propanoylamino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NC(=O)C(C)Oc1ccc(Br)cc1)c1cccs1 |
| InChI | InChI=1S/C17H18BrNO4S/c1-11(23-13-7-5-12(18)6-8-13)17(21)19-14(10-16(20)22-2)15-4-3-9-24-15/h3-9,11,14H,10H2,1-2H3,(H,19,21) |
| InChIKey | NSIWWZCQJDVZEQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |