C21H22N4OS — CID 46542771
2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 46542771) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 46542771 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-[[4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(5,6,7,8-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | Cc1ccc(-n2cnnc2SCC(=O)Nc2cccc3c2CCCC3)cc1 |
| InChI | InChI=1S/C21H22N4OS/c1-15-9-11-17(12-10-15)25-14-22-24-21(25)27-13-20(26)23-19-8-4-6-16-5-2-3-7-18(16)19/h4,6,8-12,14H,2-3,5,7,13H2,1H3,(H,23,26) |
| InChIKey | QPJLCDCOWRUSFW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |