C25H23N3O2 — CID 46546217
N-benzhydryl-N-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 46546217) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-benzhydryl-N-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-benzhydryl-N-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 46546217 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-benzhydryl-N-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | CN(C(=O)CCc1nc(-c2ccccc2)no1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23N3O2/c1-28(24(19-11-5-2-6-12-19)20-13-7-3-8-14-20)23(29)18-17-22-26-25(27-30-22)21-15-9-4-10-16-21/h2-16,24H,17-18H2,1H3 |
| InChIKey | PTAPAFLUUXRHMG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |