About N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide
N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide (PubChem CID 46546277) has the molecular formula C21H21NOS
and a molecular weight of 335.47 g/mol. Its IUPAC name is N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide |
| PubChem CID | 46546277 |
| Molecular Formula | C21H21NOS |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C(c2ccccc2)c2ccccc2)sc1C |
| InChI | InChI=1S/C21H21NOS/c1-15-14-19(24-16(15)2)21(23)22(3)20(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-14,20H,1-3H3 |
| InChIKey | GRROMVICQIYPAB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide?
The IUPAC name of N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide (CID 46546277) is N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide.
What is the SMILES notation for N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide?
The canonical SMILES for N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide is Cc1cc(C(=O)N(C)C(c2ccccc2)c2ccccc2)sc1C.
What is the InChIKey of N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide?
The InChIKey is GRROMVICQIYPAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NOS/c1-15-14-19(24-16(15)2)21(23)22(3)20(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-14,20H,1-3H3.
What are the key properties of N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide?
N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide has a molecular weight of 335.47 g/mol, XLogP of 5.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzhydryl-N,4,5-trimethylthiophene-2-carboxamide is sourced from PubChem (CID 46546277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).