C24H23N3O3 — CID 46546333
N-[3-[2-oxo-2-[[phenyl(pyridin-2-yl)methyl]amino]ethoxy]phenyl]cyclopropanecarboxamide (PubChem CID 46546333) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[3-[2-oxo-2-[[phenyl(pyridin-2-yl)methyl]amino]ethoxy]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[2-oxo-2-[[phenyl(pyridin-2-yl)methyl]amino]ethoxy]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46546333 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-[3-[2-oxo-2-[[phenyl(pyridin-2-yl)methyl]amino]ethoxy]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(COc1cccc(NC(=O)C2CC2)c1)NC(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C24H23N3O3/c28-22(16-30-20-10-6-9-19(15-20)26-24(29)18-12-13-18)27-23(17-7-2-1-3-8-17)21-11-4-5-14-25-21/h1-11,14-15,18,23H,12-13,16H2,(H,26,29)(H,27,28) |
| InChIKey | GZIJCELUFOZNGA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |