C15H8F10N2 — CID 4654763
N,N'-bis(2,3,4,5,6-pentafluorophenyl)propane-1,3-diamine (PubChem CID 4654763) has the molecular formula C15H8F10N2 and a molecular weight of 406.22 g/mol. Its IUPAC name is N,N'-bis(2,3,4,5,6-pentafluorophenyl)propane-1,3-diamine.
| Compound Name | N,N'-bis(2,3,4,5,6-pentafluorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 4654763 |
| Molecular Formula | C15H8F10N2 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | N,N'-bis(2,3,4,5,6-pentafluorophenyl)propane-1,3-diamine |
| SMILES | Fc1c(F)c(F)c(NCCCNc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C15H8F10N2/c16-4-6(18)10(22)14(11(23)7(4)19)26-2-1-3-27-15-12(24)8(20)5(17)9(21)13(15)25/h26-27H,1-3H2 |
| InChIKey | CQRXAMWDCKVCGU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|