C14H15F3N4OS — CID 46548779
N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide (PubChem CID 46548779) has the molecular formula C14H15F3N4OS and a molecular weight of 344.36 g/mol. Its IUPAC name is N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide.
| Compound Name | N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46548779 |
| Molecular Formula | C14H15F3N4OS |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
| SMILES | O=C(Nc1n[nH]c(C(F)(F)F)n1)c1cc2c(s1)CCCCCC2 |
| InChI | InChI=1S/C14H15F3N4OS/c15-14(16,17)12-19-13(21-20-12)18-11(22)10-7-8-5-3-1-2-4-6-9(8)23-10/h7H,1-6H2,(H2,18,19,20,21,22) |
| InChIKey | JAKFPTRWJWDNDE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |