C15H22N4O2S — CID 46551076
3-methyl-N-(5-octyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-5-carboxamide (PubChem CID 46551076) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 3-methyl-N-(5-octyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-methyl-N-(5-octyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 46551076 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-methyl-N-(5-octyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-5-carboxamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)c2cc(C)no2)s1 |
| InChI | InChI=1S/C15H22N4O2S/c1-3-4-5-6-7-8-9-13-17-18-15(22-13)16-14(20)12-10-11(2)19-21-12/h10H,3-9H2,1-2H3,(H,16,18,20) |
| InChIKey | ZXNVXAXIVMGVRZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|