C24H24N4O4 — CID 46551082
N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-4-(phenylcarbamoylamino)benzamide (PubChem CID 46551082) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-4-(phenylcarbamoylamino)benzamide.
| Compound Name | N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-4-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 46551082 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-4-(phenylcarbamoylamino)benzamide |
| SMILES | COc1ccc(C)cc1NC(=O)CNC(=O)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N4O4/c1-16-8-13-21(32-2)20(14-16)28-22(29)15-25-23(30)17-9-11-19(12-10-17)27-24(31)26-18-6-4-3-5-7-18/h3-14H,15H2,1-2H3,(H,25,30)(H,28,29)(H2,26,27,31) |
| InChIKey | QXJSXFCZWPWYHV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |