C32H50O8 — CID 4655379
1,5,9-trimethyl-10-[2-[(1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-yl)oxy]ethoxy]-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane (PubChem CID 4655379) has the molecular formula C32H50O8 and a molecular weight of 562.74 g/mol. Its IUPAC name is 1,5,9-trimethyl-10-[2-[(1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-yl)oxy]ethoxy]-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane.
| Compound Name | 1,5,9-trimethyl-10-[2-[(1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-yl)oxy]ethoxy]-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane |
|---|---|
| PubChem CID | 4655379 |
| Molecular Formula | C32H50O8 |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | 1,5,9-trimethyl-10-[2-[(1,5,9-trimethyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-yl)oxy]ethoxy]-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecane |
| SMILES | CC1CCC2C(C)C(OCCOC3OC4OC5(C)CCC6C(C)CCC(C3C)C46O5)OC3OC4(C)CCC1C32O4 |
| InChI | InChI=1S/C32H50O8/c1-17-7-9-23-19(3)25(35-27-31(23)21(17)11-13-29(5,37-27)39-31)33-15-16-34-26-20(4)24-10-8-18(2)22-12-14-30(6)38-28(36-26)32(22,24)40-30/h17-28H,7-16H2,1-6H3 |
| InChIKey | ITARMHUQBFBLID-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|