C18H18N2O2 — CID 46555962
N-(4-ethylphenyl)-6-methoxy-1H-indole-2-carboxamide (PubChem CID 46555962) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-(4-ethylphenyl)-6-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-(4-ethylphenyl)-6-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46555962 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-(4-ethylphenyl)-6-methoxy-1H-indole-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2cc3ccc(OC)cc3[nH]2)cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-3-12-4-7-14(8-5-12)19-18(21)17-10-13-6-9-15(22-2)11-16(13)20-17/h4-11,20H,3H2,1-2H3,(H,19,21) |
| InChIKey | NDCVFNNKZJAONS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |