C27H23FN4O2 — CID 46557225
4-[(E)-3-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide (PubChem CID 46557225) has the molecular formula C27H23FN4O2 and a molecular weight of 454.51 g/mol. Its IUPAC name is 4-[(E)-3-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide.
| Compound Name | 4-[(E)-3-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 46557225 |
| Molecular Formula | C27H23FN4O2 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 4-[(E)-3-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methylamino]-3-oxoprop-1-enyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)NCc2cn(-c3ccccc3)nc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H23FN4O2/c1-29-27(34)21-10-7-19(8-11-21)9-16-25(33)30-17-22-18-32(24-5-3-2-4-6-24)31-26(22)20-12-14-23(28)15-13-20/h2-16,18H,17H2,1H3,(H,29,34)(H,30,33)/b16-9+ |
| InChIKey | WJIYPOPGJMDDJB-CXUHLZMHSA-N |
| XLogP | 4.37 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|