C23H28N4O3 — CID 46557950
tert-butyl N-[4-[2-oxo-2-[(1-propylbenzimidazol-2-yl)amino]ethyl]phenyl]carbamate (PubChem CID 46557950) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is tert-butyl N-[4-[2-oxo-2-[(1-propylbenzimidazol-2-yl)amino]ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-oxo-2-[(1-propylbenzimidazol-2-yl)amino]ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 46557950 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | tert-butyl N-[4-[2-oxo-2-[(1-propylbenzimidazol-2-yl)amino]ethyl]phenyl]carbamate |
| SMILES | CCCn1c(NC(=O)Cc2ccc(NC(=O)OC(C)(C)C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C23H28N4O3/c1-5-14-27-19-9-7-6-8-18(19)25-21(27)26-20(28)15-16-10-12-17(13-11-16)24-22(29)30-23(2,3)4/h6-13H,5,14-15H2,1-4H3,(H,24,29)(H,25,26,28) |
| InChIKey | ZCDMWISKRWBSFP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |