C19H23N5OS4 — CID 46558395
4-[[4-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]morpholine (PubChem CID 46558395) has the molecular formula C19H23N5OS4 and a molecular weight of 465.70 g/mol. Its IUPAC name is 4-[[4-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]morpholine.
| Compound Name | 4-[[4-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 46558395 |
| Molecular Formula | C19H23N5OS4 |
| Molecular Weight | 465.70 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 4-[[4-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]methyl]morpholine |
| SMILES | CCSc1nnc(Sc2nc(CN3CCOCC3)nc3sc4c(c23)CCCC4)s1 |
| InChI | InChI=1S/C19H23N5OS4/c1-2-26-18-22-23-19(29-18)28-17-15-12-5-3-4-6-13(12)27-16(15)20-14(21-17)11-24-7-9-25-10-8-24/h2-11H2,1H3 |
| InChIKey | ZTZKYUVGRURAJF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.70 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |