C18H20N4O3S2 — CID 46560240
3,4-dimethyl-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-5-(methylsulfamoyl)benzamide (PubChem CID 46560240) has the molecular formula C18H20N4O3S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-5-(methylsulfamoyl)benzamide.
| Compound Name | 3,4-dimethyl-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46560240 |
| Molecular Formula | C18H20N4O3S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 3,4-dimethyl-N-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)amino]-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N/N=c2\sc3ccccc3n2C)cc(C)c1C |
| InChI | InChI=1S/C18H20N4O3S2/c1-11-9-13(10-16(12(11)2)27(24,25)19-3)17(23)20-21-18-22(4)14-7-5-6-8-15(14)26-18/h5-10,19H,1-4H3,(H,20,23)/b21-18- |
| InChIKey | FSYHEWASERSOOF-UZYVYHOESA-N |
| XLogP | 2.01 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|