C25H20I2N4O2 — CID 4656028
4-(3,5-diiodo-4-methoxyphenyl)-2-methyl-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide (PubChem CID 4656028) has the molecular formula C25H20I2N4O2 and a molecular weight of 662.27 g/mol. Its IUPAC name is 4-(3,5-diiodo-4-methoxyphenyl)-2-methyl-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide.
| Compound Name | 4-(3,5-diiodo-4-methoxyphenyl)-2-methyl-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide |
|---|---|
| PubChem CID | 4656028 |
| Molecular Formula | C25H20I2N4O2 |
| Molecular Weight | 662.27 g/mol |
| Exact Mass | 661.97 |
| IUPAC Name | 4-(3,5-diiodo-4-methoxyphenyl)-2-methyl-N-phenyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxamide |
| SMILES | COc1c(I)cc(C2C(C(=O)Nc3ccccc3)=C(C)Nc3nc4ccccc4n32)cc1I |
| InChI | InChI=1S/C25H20I2N4O2/c1-14-21(24(32)29-16-8-4-3-5-9-16)22(15-12-17(26)23(33-2)18(27)13-15)31-20-11-7-6-10-19(20)30-25(31)28-14/h3-13,22H,1-2H3,(H,28,30)(H,29,32) |
| InChIKey | OLGCCECSYGKPNA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.27 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|