C18H20ClN3O5 — CID 46561692
N-(2-chlorophenyl)-2-[[2-hydroxy-3-(3-nitrophenoxy)propyl]-methylamino]acetamide (PubChem CID 46561692) has the molecular formula C18H20ClN3O5 and a molecular weight of 393.83 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[[2-hydroxy-3-(3-nitrophenoxy)propyl]-methylamino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[[2-hydroxy-3-(3-nitrophenoxy)propyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 46561692 |
| Molecular Formula | C18H20ClN3O5 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-(2-chlorophenyl)-2-[[2-hydroxy-3-(3-nitrophenoxy)propyl]-methylamino]acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)CC(O)COc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20ClN3O5/c1-21(11-18(24)20-17-8-3-2-7-16(17)19)10-14(23)12-27-15-6-4-5-13(9-15)22(25)26/h2-9,14,23H,10-12H2,1H3,(H,20,24) |
| InChIKey | YPZOWOVLAAIXSR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|