C19H17N5OS2 — CID 46562378
4-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-phenyl-1,3-thiazol-2-amine (PubChem CID 46562378) has the molecular formula C19H17N5OS2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-phenyl-1,3-thiazol-2-amine.
| Compound Name | 4-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 46562378 |
| Molecular Formula | C19H17N5OS2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-N-phenyl-1,3-thiazol-2-amine |
| SMILES | C=CCn1c(SCc2csc(Nc3ccccc3)n2)nnc1-c1ccco1 |
| InChI | InChI=1S/C19H17N5OS2/c1-2-10-24-17(16-9-6-11-25-16)22-23-19(24)27-13-15-12-26-18(21-15)20-14-7-4-3-5-8-14/h2-9,11-12H,1,10,13H2,(H,20,21) |
| InChIKey | AOOBVPZJMIVILS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|