C20H23N3O2S — CID 46563213
3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-(3-phenylsulfanylpropyl)propanamide (PubChem CID 46563213) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-(3-phenylsulfanylpropyl)propanamide.
| Compound Name | 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-(3-phenylsulfanylpropyl)propanamide |
|---|---|
| PubChem CID | 46563213 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-(3-phenylsulfanylpropyl)propanamide |
| SMILES | Cc1[nH]c(=O)c(C#N)c(C)c1CCC(=O)NCCCSc1ccccc1 |
| InChI | InChI=1S/C20H23N3O2S/c1-14-17(15(2)23-20(25)18(14)13-21)9-10-19(24)22-11-6-12-26-16-7-4-3-5-8-16/h3-5,7-8H,6,9-12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | FUZGKHGVJXUGJE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|