About 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone
2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone (PubChem CID 4656759) has the molecular formula C18H16Cl2N2OS
and a molecular weight of 379.31 g/mol. Its IUPAC name is 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone.
Molecular Properties
| Compound Name | 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone |
| PubChem CID | 4656759 |
| Molecular Formula | C18H16Cl2N2OS |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(CN1CCS/C1=N\Cc1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N2OS/c19-15-7-6-14(10-16(15)20)17(23)12-22-8-9-24-18(22)21-11-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2/b21-18- |
| InChIKey | KWBVYIULQOVUJM-UZYVYHOESA-N |
| XLogP | 4.78 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone?
The IUPAC name of 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone (CID 4656759) is 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone.
What is the SMILES notation for 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone?
The canonical SMILES for 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone is O=C(CN1CCS/C1=N\Cc1ccccc1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone?
The InChIKey is KWBVYIULQOVUJM-UZYVYHOESA-N. The full InChI is InChI=1S/C18H16Cl2N2OS/c19-15-7-6-14(10-16(15)20)17(23)12-22-8-9-24-18(22)21-11-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2/b21-18-.
What are the key properties of 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone?
2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone has a molecular weight of 379.31 g/mol, XLogP of 4.78, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzylimino-1,3-thiazolidin-3-yl)-1-(3,4-dichlorophenyl)ethanone is sourced from PubChem (CID 4656759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).