About [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone
[4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone (PubChem CID 46568147) has the molecular formula C23H28N4O2
and a molecular weight of 392.50 g/mol. Its IUPAC name is [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone.
Molecular Properties
| Compound Name | [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone |
| PubChem CID | 46568147 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone |
| SMILES | CC(c1nc(C(C)(C)C)no1)N1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C23H28N4O2/c1-16(20-24-22(25-29-20)23(2,3)4)26-12-14-27(15-13-26)21(28)19-11-7-9-17-8-5-6-10-18(17)19/h5-11,16H,12-15H2,1-4H3 |
| InChIKey | PCDHDRGBODTYIS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone?
The IUPAC name of [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone (CID 46568147) is [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone.
What is the SMILES notation for [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone?
The canonical SMILES for [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone is CC(c1nc(C(C)(C)C)no1)N1CCN(C(=O)c2cccc3ccccc23)CC1.
What is the InChIKey of [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone?
The InChIKey is PCDHDRGBODTYIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4O2/c1-16(20-24-22(25-29-20)23(2,3)4)26-12-14-27(15-13-26)21(28)19-11-7-9-17-8-5-6-10-18(17)19/h5-11,16H,12-15H2,1-4H3.
What are the key properties of [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone?
[4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone has a molecular weight of 392.50 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone is sourced from PubChem (CID 46568147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).