C24H25N3O4 — CID 46568492
1-(2,3-dimethylphenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 46568492) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2,3-dimethylphenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46568492 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1cccc(N2CC(C(=O)Nc3ccc(CN4C(=O)CCC4=O)cc3)CC2=O)c1C |
| InChI | InChI=1S/C24H25N3O4/c1-15-4-3-5-20(16(15)2)26-14-18(12-23(26)30)24(31)25-19-8-6-17(7-9-19)13-27-21(28)10-11-22(27)29/h3-9,18H,10-14H2,1-2H3,(H,25,31) |
| InChIKey | NXOYVGWGGTWDAG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|