C23H21N7O5S — CID 4656933
2-[[4-(2,5-dimethylphenyl)-5-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide (PubChem CID 4656933) has the molecular formula C23H21N7O5S and a molecular weight of 507.53 g/mol. Its IUPAC name is 2-[[4-(2,5-dimethylphenyl)-5-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[[4-(2,5-dimethylphenyl)-5-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4656933 |
| Molecular Formula | C23H21N7O5S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 2-[[4-(2,5-dimethylphenyl)-5-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(C)c(-n2c(Cc3cc(=O)[nH]c(=O)[nH]3)nnc2SCC(=O)Nc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H21N7O5S/c1-13-6-7-14(2)18(8-13)29-19(10-16-11-20(31)26-22(33)25-16)27-28-23(29)36-12-21(32)24-15-4-3-5-17(9-15)30(34)35/h3-9,11H,10,12H2,1-2H3,(H,24,32)(H2,25,26,31,33) |
| InChIKey | KOEZAEOBIUSAMQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 168.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|