C25H24N2O5 — CID 46569487
1-(3,4-dimethoxyphenyl)-5-oxo-N-(2-phenoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 46569487) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-5-oxo-N-(2-phenoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-5-oxo-N-(2-phenoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46569487 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-5-oxo-N-(2-phenoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2CC(C(=O)Nc3ccccc3Oc3ccccc3)CC2=O)cc1OC |
| InChI | InChI=1S/C25H24N2O5/c1-30-22-13-12-18(15-23(22)31-2)27-16-17(14-24(27)28)25(29)26-20-10-6-7-11-21(20)32-19-8-4-3-5-9-19/h3-13,15,17H,14,16H2,1-2H3,(H,26,29) |
| InChIKey | RMKYVLYGDQGAKC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |