C23H22N4O4S2 — CID 46570137
N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide (PubChem CID 46570137) has the molecular formula C23H22N4O4S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide.
| Compound Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 46570137 |
| Molecular Formula | C23H22N4O4S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-2-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1nc2sc3c(c2c(=O)[nH]1)CCC3)Nc1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C23H22N4O4S2/c28-18(24-14-6-4-13(5-7-14)10-27-19(29)8-9-20(27)30)12-32-11-17-25-22(31)21-15-2-1-3-16(15)33-23(21)26-17/h4-7H,1-3,8-12H2,(H,24,28)(H,25,26,31) |
| InChIKey | DXWYMBCBIGGNQC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|