C23H30N2O3 — CID 46570300
2-adamantyl-[4-(4-methoxybenzoyl)piperazin-1-yl]methanone (PubChem CID 46570300) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2-adamantyl-[4-(4-methoxybenzoyl)piperazin-1-yl]methanone.
| Compound Name | 2-adamantyl-[4-(4-methoxybenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46570300 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2-adamantyl-[4-(4-methoxybenzoyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(C(=O)C3C4CC5CC(C4)CC3C5)CC2)cc1 |
| InChI | InChI=1S/C23H30N2O3/c1-28-20-4-2-17(3-5-20)22(26)24-6-8-25(9-7-24)23(27)21-18-11-15-10-16(13-18)14-19(21)12-15/h2-5,15-16,18-19,21H,6-14H2,1H3 |
| InChIKey | DWZVITZBDSFSKQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |