C26H33N3O4 — CID 46570379
N-[1-[4-(3-methoxybenzoyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide (PubChem CID 46570379) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[1-[4-(3-methoxybenzoyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide.
| Compound Name | N-[1-[4-(3-methoxybenzoyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 46570379 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | N-[1-[4-(3-methoxybenzoyl)piperazin-1-yl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide |
| SMILES | COc1cccc(C(=O)N2CCN(C(=O)C(CC(C)C)NC(=O)c3ccccc3C)CC2)c1 |
| InChI | InChI=1S/C26H33N3O4/c1-18(2)16-23(27-24(30)22-11-6-5-8-19(22)3)26(32)29-14-12-28(13-15-29)25(31)20-9-7-10-21(17-20)33-4/h5-11,17-18,23H,12-16H2,1-4H3,(H,27,30) |
| InChIKey | XPVNVRCSEIODFB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |