C17H25N3OS — CID 46571134
N-heptan-2-yl-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 46571134) has the molecular formula C17H25N3OS and a molecular weight of 319.47 g/mol. Its IUPAC name is N-heptan-2-yl-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-heptan-2-yl-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 46571134 |
| Molecular Formula | C17H25N3OS |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-heptan-2-yl-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCCCCC(C)NC(=O)c1sc2nc(C)nc(C)c2c1C |
| InChI | InChI=1S/C17H25N3OS/c1-6-7-8-9-10(2)18-16(21)15-11(3)14-12(4)19-13(5)20-17(14)22-15/h10H,6-9H2,1-5H3,(H,18,21) |
| InChIKey | XNCMYHLMAOEFTH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|