C24H21FN4OS — CID 46571486
2-(4-fluorophenyl)-4-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)morpholine (PubChem CID 46571486) has the molecular formula C24H21FN4OS and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)morpholine.
| Compound Name | 2-(4-fluorophenyl)-4-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)morpholine |
|---|---|
| PubChem CID | 46571486 |
| Molecular Formula | C24H21FN4OS |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-(4-fluorophenyl)-4-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)morpholine |
| SMILES | Fc1ccc(C2CN(c3nc(-c4cccnc4)nc4sc5c(c34)CCC5)CCO2)cc1 |
| InChI | InChI=1S/C24H21FN4OS/c25-17-8-6-15(7-9-17)19-14-29(11-12-30-19)23-21-18-4-1-5-20(18)31-24(21)28-22(27-23)16-3-2-10-26-13-16/h2-3,6-10,13,19H,1,4-5,11-12,14H2 |
| InChIKey | IFTAKKIIWCMMGH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |