About (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate
(8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate (PubChem CID 4657226) has the molecular formula C17H24NO2+
and a molecular weight of 274.38 g/mol. Its IUPAC name is (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate.
Molecular Properties
| Compound Name | (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate |
| PubChem CID | 4657226 |
| Molecular Formula | C17H24NO2+ |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OC2CC3CCC(C2)[NH+]3C)c1 |
| InChI | InChI=1S/C17H23NO2/c1-11-6-12(2)8-13(7-11)17(19)20-16-9-14-4-5-15(10-16)18(14)3/h6-8,14-16H,4-5,9-10H2,1-3H3/p+1 |
| InChIKey | HDDNYFLPWFSBLN-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate?
The IUPAC name of (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate (CID 4657226) is (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate.
What is the SMILES notation for (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate?
The canonical SMILES for (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate is Cc1cc(C)cc(C(=O)OC2CC3CCC(C2)[NH+]3C)c1.
What is the InChIKey of (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate?
The InChIKey is HDDNYFLPWFSBLN-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H23NO2/c1-11-6-12(2)8-13(7-11)17(19)20-16-9-14-4-5-15(10-16)18(14)3/h6-8,14-16H,4-5,9-10H2,1-3H3/p+1.
What are the key properties of (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate?
(8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate has a molecular weight of 274.38 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl) 3,5-dimethylbenzoate is sourced from PubChem (CID 4657226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).